C24H30FN3O4 — CID 90982561
1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-one (PubChem CID 90982561) has the molecular formula C24H30FN3O4 and a molecular weight of 443.52 g/mol. Its IUPAC name is 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-one.
| Compound Name | 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 90982561 |
| Molecular Formula | C24H30FN3O4 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-(1,3-dihydroxy-4,7-dihydroisoindol-2-yl)-3-[4-(4-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propan-2-one |
| SMILES | CC(C)Oc1cc(F)ccc1N1CCN(CC(=O)Cn2c(O)c3c(c2O)CC=CC3)CC1 |
| InChI | InChI=1S/C24H30FN3O4/c1-16(2)32-22-13-17(25)7-8-21(22)27-11-9-26(10-12-27)14-18(29)15-28-23(30)19-5-3-4-6-20(19)24(28)31/h3-4,7-8,13,16,30-31H,5-6,9-12,14-15H2,1-2H3 |
| InChIKey | XWQDRVNKCPNBAC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|