C32H28Cl2FN3O — CID 90982782
1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydrocyclohepta[d]pyrazole-3-carboxamide (PubChem CID 90982782) has the molecular formula C32H28Cl2FN3O and a molecular weight of 560.50 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydrocyclohepta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydrocyclohepta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 90982782 |
| Molecular Formula | C32H28Cl2FN3O |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-8-[(4-fluorophenyl)methylidene]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-4,5,6,7-tetrahydrocyclohepta[d]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCc2ccccc21)c1nn(-c2ccc(Cl)cc2Cl)c2c1CCCCC2=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C32H28Cl2FN3O/c33-23-14-17-29(27(34)19-23)38-31-22(18-20-12-15-24(35)16-13-20)7-2-4-10-26(31)30(37-38)32(39)36-28-11-5-8-21-6-1-3-9-25(21)28/h1,3,6,9,12-19,28H,2,4-5,7-8,10-11H2,(H,36,39)/t28-/m1/s1 |
| InChIKey | YMNOXXRDLJAWJY-MUUNZHRXSA-N |
| XLogP | 8.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |