C41H24F5N7 — CID 90982815
5-(2,3,4,5,6-pentafluorophenyl)-10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 90982815) has the molecular formula C41H24F5N7 and a molecular weight of 709.68 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)-10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)-10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90982815 |
| Molecular Formula | C41H24F5N7 |
| Molecular Weight | 709.68 g/mol |
| Exact Mass | 709.20 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)-10,15,20-tripyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3ccncc3)=c3ccc([nH]3)=C(c3ccncc3)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C41H24F5N7/c42-37-36(38(43)40(45)41(46)39(37)44)35-30-7-5-28(52-30)33(22-11-17-48-18-12-22)26-3-1-24(50-26)32(21-9-15-47-16-10-21)25-2-4-27(51-25)34(23-13-19-49-20-14-23)29-6-8-31(35)53-29/h1-20,50-53H |
| InChIKey | MMWCNKSQCGOTEV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|