C14H23N — CID 90983461
(3E,5Z)-8-ethyl-N,3-dimethyldeca-3,5,7-trien-2-imine (PubChem CID 90983461) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3E,5Z)-8-ethyl-N,3-dimethyldeca-3,5,7-trien-2-imine.
| Compound Name | (3E,5Z)-8-ethyl-N,3-dimethyldeca-3,5,7-trien-2-imine |
|---|---|
| PubChem CID | 90983461 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3E,5Z)-8-ethyl-N,3-dimethyldeca-3,5,7-trien-2-imine |
| SMILES | CCC(=C/C=C\C=C(C)\C(C)=N\C)CC |
| InChI | InChI=1S/C14H23N/c1-6-14(7-2)11-9-8-10-12(3)13(4)15-5/h8-11H,6-7H2,1-5H3/b9-8-,12-10+,15-13+ |
| InChIKey | DUPWWEFXORDNIQ-VNOZSGQLSA-N |
| XLogP | 4.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|