C16H24O9 — CID 90983698
(2S,3S,4S,5R)-6-[(3,6-dimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 90983698) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[(3,6-dimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[(3,6-dimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90983698 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (2S,3S,4S,5R)-6-[(3,6-dimethyl-2-oxo-3,3a,4,5,6,7-hexahydro-1-benzofuran-7a-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1CCC2C(C)C(=O)OC2(OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)C1 |
| InChI | InChI=1S/C16H24O9/c1-6-3-4-8-7(2)14(22)24-16(8,5-6)25-15-11(19)9(17)10(18)12(23-15)13(20)21/h6-12,15,17-19H,3-5H2,1-2H3,(H,20,21)/t6?,7?,8?,9-,10-,11+,12-,15?,16?/m0/s1 |
| InChIKey | QGSVAPZSAOSWEU-FZIGCAGXSA-N |
| XLogP | -0.78 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |