About methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate
methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate (PubChem CID 90983743) has the molecular formula C11H17N2O2+
and a molecular weight of 209.27 g/mol. Its IUPAC name is methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate |
| PubChem CID | 90983743 |
| Molecular Formula | C11H17N2O2+ |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate |
| SMILES | CCc1nc(C)c(C)[n+](C)c1C(=O)OC |
| InChI | InChI=1S/C11H17N2O2/c1-6-9-10(11(14)15-5)13(4)8(3)7(2)12-9/h6H2,1-5H3/q+1 |
| InChIKey | UDSNTYLJGHTRDL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate?
The IUPAC name of methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate (CID 90983743) is methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate.
What is the SMILES notation for methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate?
The canonical SMILES for methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate is CCc1nc(C)c(C)[n+](C)c1C(=O)OC.
What is the InChIKey of methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate?
The InChIKey is UDSNTYLJGHTRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N2O2/c1-6-9-10(11(14)15-5)13(4)8(3)7(2)12-9/h6H2,1-5H3/q+1.
What are the key properties of methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate?
methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate has a molecular weight of 209.27 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethyl-1,5,6-trimethylpyrazin-1-ium-2-carboxylate is sourced from PubChem (CID 90983743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).