About 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene
4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene (PubChem CID 90985144) has the molecular formula C14H18S
and a molecular weight of 218.37 g/mol. Its IUPAC name is 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene.
Molecular Properties
| Compound Name | 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
| PubChem CID | 90985144 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene |
| SMILES | CC=C(C)c1cc2c(s1)C1CCC2CC1 |
| InChI | InChI=1S/C14H18S/c1-3-9(2)13-8-12-10-4-6-11(7-5-10)14(12)15-13/h3,8,10-11H,4-7H2,1-2H3 |
| InChIKey | IXTWORHOICAQMQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The IUPAC name of 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene (CID 90985144) is 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene.
What is the SMILES notation for 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The canonical SMILES for 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene is CC=C(C)c1cc2c(s1)C1CCC2CC1.
What is the InChIKey of 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
The InChIKey is IXTWORHOICAQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18S/c1-3-9(2)13-8-12-10-4-6-11(7-5-10)14(12)15-13/h3,8,10-11H,4-7H2,1-2H3.
What are the key properties of 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene?
4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene has a molecular weight of 218.37 g/mol, XLogP of 4.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-2-en-2-yl-3-thiatricyclo[5.2.2.02,6]undeca-2(6),4-diene is sourced from PubChem (CID 90985144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).