About 4-methyl-1H-pyrrolo[3,2-b]pyrrole
4-methyl-1H-pyrrolo[3,2-b]pyrrole (PubChem CID 90985213) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 4-methyl-1H-pyrrolo[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 4-methyl-1H-pyrrolo[3,2-b]pyrrole |
| PubChem CID | 90985213 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 4-methyl-1H-pyrrolo[3,2-b]pyrrole |
| SMILES | Cn1ccc2[nH]ccc21 |
| InChI | InChI=1S/C7H8N2/c1-9-5-3-6-7(9)2-4-8-6/h2-5,8H,1H3 |
| InChIKey | TUURTCUVTCUQLT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-1H-pyrrolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1H-pyrrolo[3,2-b]pyrrole?
The IUPAC name of 4-methyl-1H-pyrrolo[3,2-b]pyrrole (CID 90985213) is 4-methyl-1H-pyrrolo[3,2-b]pyrrole.
What is the SMILES notation for 4-methyl-1H-pyrrolo[3,2-b]pyrrole?
The canonical SMILES for 4-methyl-1H-pyrrolo[3,2-b]pyrrole is Cn1ccc2[nH]ccc21.
What is the InChIKey of 4-methyl-1H-pyrrolo[3,2-b]pyrrole?
The InChIKey is TUURTCUVTCUQLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-9-5-3-6-7(9)2-4-8-6/h2-5,8H,1H3.
What are the key properties of 4-methyl-1H-pyrrolo[3,2-b]pyrrole?
4-methyl-1H-pyrrolo[3,2-b]pyrrole has a molecular weight of 120.15 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1H-pyrrolo[3,2-b]pyrrole is sourced from PubChem (CID 90985213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).