C20H31F3O3 — CID 90985413
20,20,20-trifluoro-19-oxoicosa-9,12-dienoic acid (PubChem CID 90985413) has the molecular formula C20H31F3O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 20,20,20-trifluoro-19-oxoicosa-9,12-dienoic acid.
| Compound Name | 20,20,20-trifluoro-19-oxoicosa-9,12-dienoic acid |
|---|---|
| PubChem CID | 90985413 |
| Molecular Formula | C20H31F3O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 20,20,20-trifluoro-19-oxoicosa-9,12-dienoic acid |
| SMILES | O=C(O)CCCCCCCC=CCC=CCCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H31F3O3/c21-20(22,23)18(24)16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(25)26/h1,3-4,6H,2,5,7-17H2,(H,25,26) |
| InChIKey | AHFNGXIGRVVULL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|