C17H15BrN2O3 — CID 90985719
methyl 5-bromo-3-[(4-methoxyphenyl)methyl]-2H-indazole-7-carboxylate (PubChem CID 90985719) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is methyl 5-bromo-3-[(4-methoxyphenyl)methyl]-2H-indazole-7-carboxylate.
| Compound Name | methyl 5-bromo-3-[(4-methoxyphenyl)methyl]-2H-indazole-7-carboxylate |
|---|---|
| PubChem CID | 90985719 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | methyl 5-bromo-3-[(4-methoxyphenyl)methyl]-2H-indazole-7-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2c(Cc3ccc(OC)cc3)[nH]nc12 |
| InChI | InChI=1S/C17H15BrN2O3/c1-22-12-5-3-10(4-6-12)7-15-13-8-11(18)9-14(17(21)23-2)16(13)20-19-15/h3-6,8-9H,7H2,1-2H3,(H,19,20) |
| InChIKey | BQJJZOIPGXDVLX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |