About 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde
2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde (PubChem CID 90986204) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde |
| PubChem CID | 90986204 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde |
| SMILES | NC1=NC(=O)C(CC=O)S1 |
| InChI | InChI=1S/C5H6N2O2S/c6-5-7-4(9)3(10-5)1-2-8/h2-3H,1H2,(H2,6,7,9) |
| InChIKey | ZUOJOWCHWLSFGJ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde?
The IUPAC name of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde (CID 90986204) is 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde.
What is the SMILES notation for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde?
The canonical SMILES for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde is NC1=NC(=O)C(CC=O)S1.
What is the InChIKey of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde?
The InChIKey is ZUOJOWCHWLSFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c6-5-7-4(9)3(10-5)1-2-8/h2-3H,1H2,(H2,6,7,9).
What are the key properties of 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde?
2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde has a molecular weight of 158.18 g/mol, XLogP of -0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4-oxo-1,3-thiazol-5-yl)acetaldehyde is sourced from PubChem (CID 90986204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).