C17H13F3INO3 — CID 90986377
7-iodo-5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90986377) has the molecular formula C17H13F3INO3 and a molecular weight of 463.19 g/mol. Its IUPAC name is 7-iodo-5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-iodo-5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90986377 |
| Molecular Formula | C17H13F3INO3 |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 462.99 |
| IUPAC Name | 7-iodo-5-methoxy-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | COc1cc(I)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C17H13F3INO3/c1-24-13-6-11-9-22(16(23)15(11)14(21)7-13)8-10-2-4-12(5-3-10)25-17(18,19)20/h2-7,9,23H,8H2,1H3 |
| InChIKey | YDHHGLMEKJFILW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|