C30H34N2O2 — CID 90986424
(2Z)-2-[2-methyl-6-[(6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ylidene)methyl]pyran-4-ylidene]propanenitrile (PubChem CID 90986424) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is (2Z)-2-[2-methyl-6-[(6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ylidene)methyl]pyran-4-ylidene]propanenitrile.
| Compound Name | (2Z)-2-[2-methyl-6-[(6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ylidene)methyl]pyran-4-ylidene]propanenitrile |
|---|---|
| PubChem CID | 90986424 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (2Z)-2-[2-methyl-6-[(6,10,10,16,16-pentamethyl-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-ylidene)methyl]pyran-4-ylidene]propanenitrile |
| SMILES | CC1=C/C(=C(\C)C#N)C=C(C=C2C=C(C)c3cc4c5c(c3O2)C(C)(C)CCN5CCC4(C)C)O1 |
| InChI | InChI=1S/C30H34N2O2/c1-18-12-22(15-23-14-21(19(2)17-31)13-20(3)33-23)34-28-24(18)16-25-27-26(28)30(6,7)9-11-32(27)10-8-29(25,4)5/h12-16H,8-11H2,1-7H3/b21-19-,22-15? |
| InChIKey | XGKHUKXLZAIUOO-KKHRHFEPSA-N |
| XLogP | 7.19 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|