C21H29ClO5 — CID 90986753
(E)-3-(3,4-dimethylphenyl)prop-2-enoyl chloride;2,2,6-trimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol (PubChem CID 90986753) has the molecular formula C21H29ClO5 and a molecular weight of 396.91 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)prop-2-enoyl chloride;2,2,6-trimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol.
| Compound Name | (E)-3-(3,4-dimethylphenyl)prop-2-enoyl chloride;2,2,6-trimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol |
|---|---|
| PubChem CID | 90986753 |
| Molecular Formula | C21H29ClO5 |
| Molecular Weight | 396.91 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)prop-2-enoyl chloride;2,2,6-trimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol |
| SMILES | CC1(O)CC(O)C2OC(C)(C)OC2C1.Cc1ccc(/C=C/C(=O)Cl)cc1C |
| InChI | InChI=1S/C11H11ClO.C10H18O4/c1-8-3-4-10(7-9(8)2)5-6-11(12)13;1-9(2)13-7-5-10(3,12)4-6(11)8(7)14-9/h3-7H,1-2H3;6-8,11-12H,4-5H2,1-3H3/b6-5+; |
| InChIKey | FYSQPWXKBRSFGT-IPZCTEOASA-N |
| XLogP | 3.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|