C13H21F8NO — CID 90986838
difluoromethane;1-fluoropropane;1-(4,4,5,5,5-pentafluoropentan-2-yl)pyrrolidin-2-one (PubChem CID 90986838) has the molecular formula C13H21F8NO and a molecular weight of 359.30 g/mol. Its IUPAC name is difluoromethane;1-fluoropropane;1-(4,4,5,5,5-pentafluoropentan-2-yl)pyrrolidin-2-one.
| Compound Name | difluoromethane;1-fluoropropane;1-(4,4,5,5,5-pentafluoropentan-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 90986838 |
| Molecular Formula | C13H21F8NO |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | difluoromethane;1-fluoropropane;1-(4,4,5,5,5-pentafluoropentan-2-yl)pyrrolidin-2-one |
| SMILES | CC(CC(F)(F)C(F)(F)F)N1CCCC1=O.CCCF.FCF |
| InChI | InChI=1S/C9H12F5NO.C3H7F.CH2F2/c1-6(15-4-2-3-7(15)16)5-8(10,11)9(12,13)14;1-2-3-4;2-1-3/h6H,2-5H2,1H3;2-3H2,1H3;1H2 |
| InChIKey | JHVUWBKPPKXMFG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|