C29H36N4O4S — CID 90987279
5-(cyclohexa-1,5-dien-1-ylmethylsulfonyl)-3-[[4-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one (PubChem CID 90987279) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is 5-(cyclohexa-1,5-dien-1-ylmethylsulfonyl)-3-[[4-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one.
| Compound Name | 5-(cyclohexa-1,5-dien-1-ylmethylsulfonyl)-3-[[4-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one |
|---|---|
| PubChem CID | 90987279 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 5-(cyclohexa-1,5-dien-1-ylmethylsulfonyl)-3-[[4-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-5,6-dihydro-1H-indol-2-one |
| SMILES | Cc1[nH]c(C=C2C(=O)NC3=CCC(S(=O)(=O)CC4=CCCC=C4)C=C32)c(C)c1C(=O)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C29H36N4O4S/c1-17-14-33(15-18(2)30-17)29(35)27-19(3)26(31-20(27)4)13-24-23-12-22(10-11-25(23)32-28(24)34)38(36,37)16-21-8-6-5-7-9-21/h6,8-9,11-13,17-18,22,30-31H,5,7,10,14-16H2,1-4H3,(H,32,34)/t17-,18+,22? |
| InChIKey | CDXLUBNPLPPEFR-VSOVRNOCSA-N |
| XLogP | 3.24 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|