C11H16ClF2N3 — CID 90987844
7-(2-chloro-2,2-difluoroethyl)-4-propan-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine (PubChem CID 90987844) has the molecular formula C11H16ClF2N3 and a molecular weight of 263.72 g/mol. Its IUPAC name is 7-(2-chloro-2,2-difluoroethyl)-4-propan-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine.
| Compound Name | 7-(2-chloro-2,2-difluoroethyl)-4-propan-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 90987844 |
| Molecular Formula | C11H16ClF2N3 |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 7-(2-chloro-2,2-difluoroethyl)-4-propan-2-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine |
| SMILES | CC(C)C1NCC(CC(F)(F)Cl)c2nc[nH]c21 |
| InChI | InChI=1S/C11H16ClF2N3/c1-6(2)8-10-9(16-5-17-10)7(4-15-8)3-11(12,13)14/h5-8,15H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | JHVWWIVCTIRGCT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|