C22H21FN4O2 — CID 90988289
3-[(4-fluorophenyl)methyl]-7-methyl-5-[1-(methyldiazenyl)ethyl]pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 90988289) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-5-[1-(methyldiazenyl)ethyl]pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-[1-(methyldiazenyl)ethyl]pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 90988289 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-[1-(methyldiazenyl)ethyl]pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | C/N=N/C(C)c1c2cc(Cc3ccc(F)cc3)cnc2c(O)c2c(O)n(C)cc12 |
| InChI | InChI=1S/C22H21FN4O2/c1-12(26-24-2)18-16-9-14(8-13-4-6-15(23)7-5-13)10-25-20(16)21(28)19-17(18)11-27(3)22(19)29/h4-7,9-12,28-29H,8H2,1-3H3/b26-24+ |
| InChIKey | OHHOCVAMUZXNCG-SHHOIMCASA-N |
| XLogP | 5.01 |
| TPSA | 83.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|