C23H32O2 — CID 90988375
6-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl]tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 90988375) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is 6-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl]tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
| Compound Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl]tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 90988375 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 6-[2-(2-bicyclo[2.2.1]heptanyl)propan-2-yl]tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
| SMILES | CC(C)(C1CC2CCC1C2)C12CC(C(=O)O)C(C1)C1C3C=CC(C3)C12 |
| InChI | InChI=1S/C23H32O2/c1-22(2,18-8-12-3-4-13(18)7-12)23-10-16(17(11-23)21(24)25)19-14-5-6-15(9-14)20(19)23/h5-6,12-20H,3-4,7-11H2,1-2H3,(H,24,25) |
| InChIKey | ZRHZWTNZXJOFHY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|