About 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline
7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline (PubChem CID 90988576) has the molecular formula C25H19ClN2
and a molecular weight of 382.89 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline.
Molecular Properties
| Compound Name | 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline |
| PubChem CID | 90988576 |
| Molecular Formula | C25H19ClN2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline |
| SMILES | Cc1ccc2nc3c(c(C)nc4ccc(C)cc43)c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C25H19ClN2/c1-14-8-10-21-18(12-14)24(17-6-4-5-7-20(17)26)23-16(3)27-22-11-9-15(2)13-19(22)25(23)28-21/h4-13H,1-3H3 |
| InChIKey | YOPLHLXTPDEDCC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline?
The IUPAC name of 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline (CID 90988576) is 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline.
What is the SMILES notation for 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline?
The canonical SMILES for 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline is Cc1ccc2nc3c(c(C)nc4ccc(C)cc43)c(-c3ccccc3Cl)c2c1.
What is the InChIKey of 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline?
The InChIKey is YOPLHLXTPDEDCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN2/c1-14-8-10-21-18(12-14)24(17-6-4-5-7-20(17)26)23-16(3)27-22-11-9-15(2)13-19(22)25(23)28-21/h4-13H,1-3H3.
What are the key properties of 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline?
7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline has a molecular weight of 382.89 g/mol, XLogP of 7.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-chlorophenyl)-2,6,9-trimethylquinolino[4,3-b]quinoline is sourced from PubChem (CID 90988576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).