C29H54O11 — CID 90988631
ethane;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]ethoxy]oxane-2-carboxylic acid (PubChem CID 90988631) has the molecular formula C29H54O11 and a molecular weight of 578.74 g/mol. Its IUPAC name is ethane;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]ethoxy]oxane-2-carboxylic acid.
| Compound Name | ethane;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]ethoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90988631 |
| Molecular Formula | C29H54O11 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | ethane;(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[7-(3-hydroxy-5-oxo-2-pentylcyclopentyl)heptanoyloxy]ethoxy]oxane-2-carboxylic acid |
| SMILES | CC.CC.CCCCCC1C(O)CC(=O)C1CCCCCCC(=O)OCCOC1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H42O11.2C2H6/c1-2-3-6-9-15-16(18(27)14-17(15)26)10-7-4-5-8-11-19(28)34-12-13-35-25-22(31)20(29)21(30)23(36-25)24(32)33;2*1-2/h15-17,20-23,25-26,29-31H,2-14H2,1H3,(H,32,33);2*1-2H3/t15?,16?,17?,20-,21-,22+,23-,25?;;/m0../s1 |
| InChIKey | WZIULBHLCWJSNF-VPKBOEODSA-N |
| XLogP | 2.98 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|