About N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide
N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide (PubChem CID 90988690) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide.
Molecular Properties
| Compound Name | N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide |
| PubChem CID | 90988690 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide |
| SMILES | O=CNc1cccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)c1 |
| InChI | InChI=1S/C22H17N3O2/c26-14-23-16-9-6-10-17(13-16)24-21(15-7-2-1-3-8-15)20-18-11-4-5-12-19(18)25-22(20)27/h1-14,20H,(H,23,26)(H,25,27)/b24-21+ |
| InChIKey | DBCJMRQDJJHRAJ-DARPEHSRSA-N |
| XLogP | 4.11 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide?
The IUPAC name of N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide (CID 90988690) is N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide.
What is the SMILES notation for N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide?
The canonical SMILES for N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide is O=CNc1cccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccccc32)c1.
What is the InChIKey of N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide?
The InChIKey is DBCJMRQDJJHRAJ-DARPEHSRSA-N. The full InChI is InChI=1S/C22H17N3O2/c26-14-23-16-9-6-10-17(13-16)24-21(15-7-2-1-3-8-15)20-18-11-4-5-12-19(18)25-22(20)27/h1-14,20H,(H,23,26)(H,25,27)/b24-21+.
What are the key properties of N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide?
N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide has a molecular weight of 355.40 g/mol, XLogP of 4.11, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]formamide is sourced from PubChem (CID 90988690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).