C23H22FN3O3 — CID 9098933
N-(4-ethoxyphenyl)-4-[[2-(3-fluoroanilino)acetyl]amino]benzamide (PubChem CID 9098933) has the molecular formula C23H22FN3O3 and a molecular weight of 407.45 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[2-(3-fluoroanilino)acetyl]amino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[2-(3-fluoroanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 9098933 |
| Molecular Formula | C23H22FN3O3 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[2-(3-fluoroanilino)acetyl]amino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)CNc3cccc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H22FN3O3/c1-2-30-21-12-10-19(11-13-21)27-23(29)16-6-8-18(9-7-16)26-22(28)15-25-20-5-3-4-17(24)14-20/h3-14,25H,2,15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | MNAOVBUWZIYAQG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |