C32H52Cl4N8 — CID 90989349
6,15,24,33-tetrachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 90989349) has the molecular formula C32H52Cl4N8 and a molecular weight of 690.64 g/mol. Its IUPAC name is 6,15,24,33-tetrachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 6,15,24,33-tetrachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 90989349 |
| Molecular Formula | C32H52Cl4N8 |
| Molecular Weight | 690.64 g/mol |
| Exact Mass | 688.31 |
| IUPAC Name | 6,15,24,33-tetrachloro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | ClC1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CC(Cl)CCC63)C3CC(Cl)CCC53)C3CC(Cl)CCC43)C2C1 |
| InChI | InChI=1S/C32H52Cl4N8/c33-13-1-5-17-21(9-13)29-37-25(17)41-30-22-10-14(34)2-6-18(22)27(38-30)43-32-24-12-16(36)4-8-20(24)28(40-32)44-31-23-11-15(35)3-7-19(23)26(39-31)42-29/h13-32,37-44H,1-12H2 |
| InChIKey | FWEPLVAJLOXQTN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|