C9H7F3N2O4S — CID 90989521
carbamoyl 5-[[(2,2,2-trifluoroacetyl)amino]methyl]thiophene-3-carboxylate (PubChem CID 90989521) has the molecular formula C9H7F3N2O4S and a molecular weight of 296.23 g/mol. Its IUPAC name is carbamoyl 5-[[(2,2,2-trifluoroacetyl)amino]methyl]thiophene-3-carboxylate.
| Compound Name | carbamoyl 5-[[(2,2,2-trifluoroacetyl)amino]methyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 90989521 |
| Molecular Formula | C9H7F3N2O4S |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | carbamoyl 5-[[(2,2,2-trifluoroacetyl)amino]methyl]thiophene-3-carboxylate |
| SMILES | NC(=O)OC(=O)c1csc(CNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3N2O4S/c10-9(11,12)7(16)14-2-5-1-4(3-19-5)6(15)18-8(13)17/h1,3H,2H2,(H2,13,17)(H,14,16) |
| InChIKey | MMENOFIFWPRSHH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|