C20H17ClN4S — CID 90990158
4-(2-chlorophenyl)-5-isocyano-6-propyl-3-thiophen-2-yl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine (PubChem CID 90990158) has the molecular formula C20H17ClN4S and a molecular weight of 380.90 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5-isocyano-6-propyl-3-thiophen-2-yl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-(2-chlorophenyl)-5-isocyano-6-propyl-3-thiophen-2-yl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 90990158 |
| Molecular Formula | C20H17ClN4S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-(2-chlorophenyl)-5-isocyano-6-propyl-3-thiophen-2-yl-4,5-dihydro-2H-pyrazolo[3,4-b]pyridine |
| SMILES | [C-]#[N+]C1C(CCC)=Nc2n[nH]c(-c3cccs3)c2C1c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN4S/c1-3-7-14-18(22-2)16(12-8-4-5-9-13(12)21)17-19(15-10-6-11-26-15)24-25-20(17)23-14/h4-6,8-11,16,18H,3,7H2,1H3,(H,24,25) |
| InChIKey | LAHFUYSTGJLKHJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|