C9H16N4 — CID 90990198
6-azido-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 90990198) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-azido-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | 6-azido-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 90990198 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 6-azido-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | [N-]=[N+]=NC1CCC2CNCCC2C1 |
| InChI | InChI=1S/C9H16N4/c10-13-12-9-2-1-8-6-11-4-3-7(8)5-9/h7-9,11H,1-6H2 |
| InChIKey | GORPGYRWGSLVPZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|