C14H9F2N3O3 — CID 90990595
2-[3-(3,4-difluorophenyl)-1,2-oxazol-5-yl]-N-(1,2-oxazol-3-yloxy)ethenamine (PubChem CID 90990595) has the molecular formula C14H9F2N3O3 and a molecular weight of 305.24 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)-1,2-oxazol-5-yl]-N-(1,2-oxazol-3-yloxy)ethenamine.
| Compound Name | 2-[3-(3,4-difluorophenyl)-1,2-oxazol-5-yl]-N-(1,2-oxazol-3-yloxy)ethenamine |
|---|---|
| PubChem CID | 90990595 |
| Molecular Formula | C14H9F2N3O3 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)-1,2-oxazol-5-yl]-N-(1,2-oxazol-3-yloxy)ethenamine |
| SMILES | Fc1ccc(-c2cc(C=CNOc3ccon3)on2)cc1F |
| InChI | InChI=1S/C14H9F2N3O3/c15-11-2-1-9(7-12(11)16)13-8-10(21-18-13)3-5-17-22-14-4-6-20-19-14/h1-8,17H |
| InChIKey | KEHSQANZNRVHRH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|