C30H33F6N5O5 — CID 90990632
(4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]amino]-2,2-diethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid (PubChem CID 90990632) has the molecular formula C30H33F6N5O5 and a molecular weight of 657.61 g/mol. Its IUPAC name is (4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]amino]-2,2-diethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid.
| Compound Name | (4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]amino]-2,2-diethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 90990632 |
| Molecular Formula | C30H33F6N5O5 |
| Molecular Weight | 657.61 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | (4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2-methoxyethoxy)pyrimidin-2-yl]amino]-2,2-diethyl-6-methoxy-3,4-dihydro-1,5-naphthyridine-1-carboxylic acid |
| SMILES | CCC1(CC)C[C@H](Nc2ncc(OCCOC)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2nc(OC)ccc2N1C(=O)O |
| InChI | InChI=1S/C30H33F6N5O5/c1-5-28(6-2)15-21(25-22(41(28)27(42)43)7-8-24(40-25)45-4)39-26-37-16-23(46-10-9-44-3)20(38-26)13-17-11-18(29(31,32)33)14-19(12-17)30(34,35)36/h7-8,11-12,14,16,21H,5-6,9-10,13,15H2,1-4H3,(H,42,43)(H,37,38,39)/t21-/m0/s1 |
| InChIKey | IAPLSPKFKMNKBM-NRFANRHFSA-N |
| XLogP | 7.13 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.61 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|