About 3H-2-benzofuran-1-one;ethane
3H-2-benzofuran-1-one;ethane (PubChem CID 90991348) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 3H-2-benzofuran-1-one;ethane.
Molecular Properties
| Compound Name | 3H-2-benzofuran-1-one;ethane |
| PubChem CID | 90991348 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3H-2-benzofuran-1-one;ethane |
| SMILES | CC.CC.CC.O=C1OCc2ccccc21 |
| InChI | InChI=1S/C8H6O2.3C2H6/c9-8-7-4-2-1-3-6(7)5-10-8;3*1-2/h1-4H,5H2;3*1-2H3 |
| InChIKey | VUVGBWYFHFABAX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3H-2-benzofuran-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-2-benzofuran-1-one;ethane?
The IUPAC name of 3H-2-benzofuran-1-one;ethane (CID 90991348) is 3H-2-benzofuran-1-one;ethane.
What is the SMILES notation for 3H-2-benzofuran-1-one;ethane?
The canonical SMILES for 3H-2-benzofuran-1-one;ethane is CC.CC.CC.O=C1OCc2ccccc21.
What is the InChIKey of 3H-2-benzofuran-1-one;ethane?
The InChIKey is VUVGBWYFHFABAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.3C2H6/c9-8-7-4-2-1-3-6(7)5-10-8;3*1-2/h1-4H,5H2;3*1-2H3.
What are the key properties of 3H-2-benzofuran-1-one;ethane?
3H-2-benzofuran-1-one;ethane has a molecular weight of 224.34 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-2-benzofuran-1-one;ethane is sourced from PubChem (CID 90991348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).