C16H23NO4 — CID 90991509
(1S,5S,6S)-5-(1-amino-2-phenylethyl)-7,7-dimethyl-3-oxabicyclo[4.1.0]heptane-1,2,6-triol (PubChem CID 90991509) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (1S,5S,6S)-5-(1-amino-2-phenylethyl)-7,7-dimethyl-3-oxabicyclo[4.1.0]heptane-1,2,6-triol.
| Compound Name | (1S,5S,6S)-5-(1-amino-2-phenylethyl)-7,7-dimethyl-3-oxabicyclo[4.1.0]heptane-1,2,6-triol |
|---|---|
| PubChem CID | 90991509 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (1S,5S,6S)-5-(1-amino-2-phenylethyl)-7,7-dimethyl-3-oxabicyclo[4.1.0]heptane-1,2,6-triol |
| SMILES | CC1(C)[C@@]2(O)C(O)OC[C@H](C(N)Cc3ccccc3)[C@]12O |
| InChI | InChI=1S/C16H23NO4/c1-14(2)15(19)11(9-21-13(18)16(14,15)20)12(17)8-10-6-4-3-5-7-10/h3-7,11-13,18-20H,8-9,17H2,1-2H3/t11-,12?,13?,15+,16+/m1/s1 |
| InChIKey | OOQMEKFPGBREMW-OMCINKPGSA-N |
| XLogP | 0.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |