C22H29N3O4S — CID 90991620
N-(1,1-dioxothiolan-2-yl)-5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide (PubChem CID 90991620) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-2-yl)-5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-2-yl)-5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide |
|---|---|
| PubChem CID | 90991620 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-(1,1-dioxothiolan-2-yl)-5-methyl-2-(oxan-4-yl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxamide |
| SMILES | Cn1c2c(c3cc(C(=O)NC4CCCS4(=O)=O)ccc31)CN(C1CCOCC1)CC2 |
| InChI | InChI=1S/C22H29N3O4S/c1-24-19-5-4-15(22(26)23-21-3-2-12-30(21,27)28)13-17(19)18-14-25(9-6-20(18)24)16-7-10-29-11-8-16/h4-5,13,16,21H,2-3,6-12,14H2,1H3,(H,23,26) |
| InChIKey | XSLDVPVPMQSFFH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|