C7H15N3O4S — CID 90991659
(2R)-2-amino-3-[2-(2-aminoethylideneamino)ethylsulfonyl]propanoic acid (PubChem CID 90991659) has the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-(2-aminoethylideneamino)ethylsulfonyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[2-(2-aminoethylideneamino)ethylsulfonyl]propanoic acid |
|---|---|
| PubChem CID | 90991659 |
| Molecular Formula | C7H15N3O4S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2R)-2-amino-3-[2-(2-aminoethylideneamino)ethylsulfonyl]propanoic acid |
| SMILES | NC/C=N/CCS(=O)(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15N3O4S/c8-1-2-10-3-4-15(13,14)5-6(9)7(11)12/h2,6H,1,3-5,8-9H2,(H,11,12)/b10-2+/t6-/m0/s1 |
| InChIKey | RCNSKUPPMCYYLW-PJSPPHEBSA-N |
| XLogP | -2.16 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|