About 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine
6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine (PubChem CID 90992147) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine.
Analyze 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine?
The IUPAC name of 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine (CID 90992147) is 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine.
What is the SMILES notation for 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine?
The canonical SMILES for 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine is CN1C=C2OCCOC2=CC1.
What is the InChIKey of 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine?
The InChIKey is VROKWXDOCOGVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-9-3-2-7-8(6-9)11-5-4-10-7/h2,6H,3-5H2,1H3.
What are the key properties of 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine?
6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine has a molecular weight of 153.18 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3,7-dihydro-2H-[1,4]dioxino[2,3-c]pyridine is sourced from PubChem (CID 90992147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).