C24H35N3O6 — CID 90992257
(1S,19S,22S)-19-tert-butyl-17,20-dioxo-2,16-dioxa-4,18,21-triazatricyclo[19.2.1.03,8]tetracosa-3(8),4,6-triene-22-carboxylic acid (PubChem CID 90992257) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is (1S,19S,22S)-19-tert-butyl-17,20-dioxo-2,16-dioxa-4,18,21-triazatricyclo[19.2.1.03,8]tetracosa-3(8),4,6-triene-22-carboxylic acid.
| Compound Name | (1S,19S,22S)-19-tert-butyl-17,20-dioxo-2,16-dioxa-4,18,21-triazatricyclo[19.2.1.03,8]tetracosa-3(8),4,6-triene-22-carboxylic acid |
|---|---|
| PubChem CID | 90992257 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (1S,19S,22S)-19-tert-butyl-17,20-dioxo-2,16-dioxa-4,18,21-triazatricyclo[19.2.1.03,8]tetracosa-3(8),4,6-triene-22-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1NC(=O)OCCCCCCCc2cccnc2O[C@H]2C[C@@H](C(=O)O)N(C2)C1=O |
| InChI | InChI=1S/C24H35N3O6/c1-24(2,3)19-21(28)27-15-17(14-18(27)22(29)30)33-20-16(11-9-12-25-20)10-7-5-4-6-8-13-32-23(31)26-19/h9,11-12,17-19H,4-8,10,13-15H2,1-3H3,(H,26,31)(H,29,30)/t17-,18-,19+/m0/s1 |
| InChIKey | IRZYHMFCOUMCDT-GBESFXJTSA-N |
| XLogP | 3.16 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |