C20H21ClFNO7S — CID 90992647
2-acetyloxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 90992647) has the molecular formula C20H21ClFNO7S and a molecular weight of 473.91 g/mol. Its IUPAC name is 2-acetyloxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | 2-acetyloxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 90992647 |
| Molecular Formula | C20H21ClFNO7S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-acetyloxyethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1-dioxo-3,5,9,9a-tetrahydro-2H-[1,4]oxathiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC(=O)OCCOC(=O)C1=C(C)N=C2COCCS(=O)(=O)C2C1c1c(F)cccc1Cl |
| InChI | InChI=1S/C20H21ClFNO7S/c1-11-16(20(25)30-7-6-29-12(2)24)18(17-13(21)4-3-5-14(17)22)19-15(23-11)10-28-8-9-31(19,26)27/h3-5,18-19H,6-10H2,1-2H3 |
| InChIKey | KCDXXJNQHOOGEK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 108.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|