C9H18N2O — CID 90992878
3a-(ethoxymethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 90992878) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 3a-(ethoxymethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 3a-(ethoxymethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 90992878 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 3a-(ethoxymethyl)-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCOCC12CNCC1CNC2 |
| InChI | InChI=1S/C9H18N2O/c1-2-12-7-9-5-10-3-8(9)4-11-6-9/h8,10-11H,2-7H2,1H3 |
| InChIKey | LTOSNEKSRPWPQB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |