C30H25ClFNO8S2 — CID 90992896
2-(2-phenylacetyl)oxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90992896) has the molecular formula C30H25ClFNO8S2 and a molecular weight of 646.11 g/mol. Its IUPAC name is 2-(2-phenylacetyl)oxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 2-(2-phenylacetyl)oxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90992896 |
| Molecular Formula | C30H25ClFNO8S2 |
| Molecular Weight | 646.11 g/mol |
| Exact Mass | 645.07 |
| IUPAC Name | 2-(2-phenylacetyl)oxyethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCOC(=O)Cc1ccccc1)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C30H25ClFNO8S2/c1-18-26(30(35)41-15-14-40-25(34)16-19-8-3-2-4-9-19)28(27-20(31)10-7-11-21(27)32)29-22(33-18)17-42(36,37)23-12-5-6-13-24(23)43(29,38)39/h2-13,26,28H,14-17H2,1H3 |
| InChIKey | ALSSNFOXKGSKGG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.11 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|