C22H20N4O5S — CID 90993483
4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoic acid (PubChem CID 90993483) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 90993483 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[3-[[(1S)-2-methoxy-2-oxo-1-phenylethyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-4-oxobut-2-enoic acid |
| SMILES | COC(=O)[C@@H](Nc1ncnc2sc3c(c12)CCN(C(=O)C=CC(=O)O)C3)c1ccccc1 |
| InChI | InChI=1S/C22H20N4O5S/c1-31-22(30)19(13-5-3-2-4-6-13)25-20-18-14-9-10-26(16(27)7-8-17(28)29)11-15(14)32-21(18)24-12-23-20/h2-8,12,19H,9-11H2,1H3,(H,28,29)(H,23,24,25)/t19-/m0/s1 |
| InChIKey | GRZSNSAVVVQAOG-IBGZPJMESA-N |
| XLogP | 2.54 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|