C19H29N5O6 — CID 90993842
3-(2,2-dimethylbutanoylamino)-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide (PubChem CID 90993842) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoylamino)-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide.
| Compound Name | 3-(2,2-dimethylbutanoylamino)-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide |
|---|---|
| PubChem CID | 90993842 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 3-(2,2-dimethylbutanoylamino)-N-[[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]methyl]-N'-methylpentanediamide |
| SMILES | CCC(C)(C)C(=O)NC(CC(=O)NC)CC(=O)NCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H29N5O6/c1-5-19(2,3)18(30)23-12(8-13(25)20-4)9-14(26)21-11-22-15(27)10-24-16(28)6-7-17(24)29/h6-7,12H,5,8-11H2,1-4H3,(H,20,25)(H,21,26)(H,22,27)(H,23,30) |
| InChIKey | MNLSIDCWHKPNGH-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|