C30H25F2N3O3 — CID 90993994
N-(2,2-difluorobut-3-enyl)-4-(7-quinolin-3-yl-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzamide (PubChem CID 90993994) has the molecular formula C30H25F2N3O3 and a molecular weight of 513.54 g/mol. Its IUPAC name is N-(2,2-difluorobut-3-enyl)-4-(7-quinolin-3-yl-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzamide.
| Compound Name | N-(2,2-difluorobut-3-enyl)-4-(7-quinolin-3-yl-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 90993994 |
| Molecular Formula | C30H25F2N3O3 |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-(2,2-difluorobut-3-enyl)-4-(7-quinolin-3-yl-3,5-dihydro-2H-1,4-benzoxazepine-4-carbonyl)benzamide |
| SMILES | C=CC(F)(F)CNC(=O)c1ccc(C(=O)N2CCOc3ccc(-c4cnc5ccccc5c4)cc3C2)cc1 |
| InChI | InChI=1S/C30H25F2N3O3/c1-2-30(31,32)19-34-28(36)20-7-9-21(10-8-20)29(37)35-13-14-38-27-12-11-22(15-25(27)18-35)24-16-23-5-3-4-6-26(23)33-17-24/h2-12,15-17H,1,13-14,18-19H2,(H,34,36) |
| InChIKey | AHKKYXNTBDSKEC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|