C15H17NO4 — CID 90994048
(5S)-3-[(2R)-2-aminopropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 90994048) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is (5S)-3-[(2R)-2-aminopropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione.
| Compound Name | (5S)-3-[(2R)-2-aminopropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 90994048 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (5S)-3-[(2R)-2-aminopropanoyl]-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | C[C@@H](N)C(=O)C1C(=O)O[C@@H](CCc2ccccc2)C1=O |
| InChI | InChI=1S/C15H17NO4/c1-9(16)13(17)12-14(18)11(20-15(12)19)8-7-10-5-3-2-4-6-10/h2-6,9,11-12H,7-8,16H2,1H3/t9-,11+,12?/m1/s1 |
| InChIKey | NAHMQAVJFHSENV-BVAQLPTGSA-N |
| XLogP | 0.65 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|