C28H30FN5O3 — CID 90994138
3-(4-fluorophenyl)-8-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methyl]spiro[5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2,4'-oxane] (PubChem CID 90994138) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-8-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methyl]spiro[5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2,4'-oxane].
| Compound Name | 3-(4-fluorophenyl)-8-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methyl]spiro[5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2,4'-oxane] |
|---|---|
| PubChem CID | 90994138 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 3-(4-fluorophenyl)-8-[[7-(4-methylimidazol-1-yl)-1,3-benzodioxol-4-yl]methyl]spiro[5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2,4'-oxane] |
| SMILES | Cc1cn(-c2ccc(CC3CCCN4C3=NC3(CCOCC3)N4c3ccc(F)cc3)c3c2OCO3)cn1 |
| InChI | InChI=1S/C28H30FN5O3/c1-19-16-32(17-30-19)24-9-4-20(25-26(24)37-18-36-25)15-21-3-2-12-33-27(21)31-28(10-13-35-14-11-28)34(33)23-7-5-22(29)6-8-23/h4-9,16-17,21H,2-3,10-15,18H2,1H3 |
| InChIKey | XMYKPACZWJZMPR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |