C25H30N4O5S — CID 90994218
5-[2-ethylidene-5-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]hex-5-enyl]-4-hydroxy-3H-1,3-thiazol-2-one (PubChem CID 90994218) has the molecular formula C25H30N4O5S and a molecular weight of 498.61 g/mol. Its IUPAC name is 5-[2-ethylidene-5-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]hex-5-enyl]-4-hydroxy-3H-1,3-thiazol-2-one.
| Compound Name | 5-[2-ethylidene-5-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]hex-5-enyl]-4-hydroxy-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 90994218 |
| Molecular Formula | C25H30N4O5S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 5-[2-ethylidene-5-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]hex-5-enyl]-4-hydroxy-3H-1,3-thiazol-2-one |
| SMILES | C=C(CCC(=CC)Cc1sc(=O)[nH]c1O)OCCN(C)c1cc(Oc2ccc(OC)cc2)ncn1 |
| InChI | InChI=1S/C25H30N4O5S/c1-5-18(14-21-24(30)28-25(31)35-21)7-6-17(2)33-13-12-29(3)22-15-23(27-16-26-22)34-20-10-8-19(32-4)9-11-20/h5,8-11,15-16,30H,2,6-7,12-14H2,1,3-4H3,(H,28,31) |
| InChIKey | WCUAMHYQFHKYDT-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|