About ethane;4-methyl-1,2-dihydropyridin-2-ol
ethane;4-methyl-1,2-dihydropyridin-2-ol (PubChem CID 90994662) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is ethane;4-methyl-1,2-dihydropyridin-2-ol.
Molecular Properties
| Compound Name | ethane;4-methyl-1,2-dihydropyridin-2-ol |
| PubChem CID | 90994662 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | ethane;4-methyl-1,2-dihydropyridin-2-ol |
| SMILES | CC.CC1=CC(O)NC=C1 |
| InChI | InChI=1S/C6H9NO.C2H6/c1-5-2-3-7-6(8)4-5;1-2/h2-4,6-8H,1H3;1-2H3 |
| InChIKey | IGYVYNWDJWUQNY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-1,2-dihydropyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1,2-dihydropyridin-2-ol?
The IUPAC name of ethane;4-methyl-1,2-dihydropyridin-2-ol (CID 90994662) is ethane;4-methyl-1,2-dihydropyridin-2-ol.
What is the SMILES notation for ethane;4-methyl-1,2-dihydropyridin-2-ol?
The canonical SMILES for ethane;4-methyl-1,2-dihydropyridin-2-ol is CC.CC1=CC(O)NC=C1.
What is the InChIKey of ethane;4-methyl-1,2-dihydropyridin-2-ol?
The InChIKey is IGYVYNWDJWUQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C2H6/c1-5-2-3-7-6(8)4-5;1-2/h2-4,6-8H,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1,2-dihydropyridin-2-ol?
ethane;4-methyl-1,2-dihydropyridin-2-ol has a molecular weight of 141.21 g/mol, XLogP of 1.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1,2-dihydropyridin-2-ol is sourced from PubChem (CID 90994662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).