C11H18N2 — CID 90994728
3-ethylidene-1,6-dimethyl-8,9-dihydro-2H-1,4-diazonine (PubChem CID 90994728) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 3-ethylidene-1,6-dimethyl-8,9-dihydro-2H-1,4-diazonine.
| Compound Name | 3-ethylidene-1,6-dimethyl-8,9-dihydro-2H-1,4-diazonine |
|---|---|
| PubChem CID | 90994728 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 3-ethylidene-1,6-dimethyl-8,9-dihydro-2H-1,4-diazonine |
| SMILES | CC=C1CN(C)CCC=C(C)/C=N\1 |
| InChI | InChI=1S/C11H18N2/c1-4-11-9-13(3)7-5-6-10(2)8-12-11/h4,6,8H,5,7,9H2,1-3H3/b10-6?,11-4?,12-8- |
| InChIKey | AWAWBRYUXXQXAJ-PWTIWOBXSA-N |
| XLogP | 2.24 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |