C12H16F6O — CID 90994779
4,4,4-trifluoro-3,3-dimethyl-1-(4,4,4-trifluoro-3,3-dimethylbut-1-enoxy)but-1-ene (PubChem CID 90994779) has the molecular formula C12H16F6O and a molecular weight of 290.25 g/mol. Its IUPAC name is 4,4,4-trifluoro-3,3-dimethyl-1-(4,4,4-trifluoro-3,3-dimethylbut-1-enoxy)but-1-ene.
| Compound Name | 4,4,4-trifluoro-3,3-dimethyl-1-(4,4,4-trifluoro-3,3-dimethylbut-1-enoxy)but-1-ene |
|---|---|
| PubChem CID | 90994779 |
| Molecular Formula | C12H16F6O |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4,4,4-trifluoro-3,3-dimethyl-1-(4,4,4-trifluoro-3,3-dimethylbut-1-enoxy)but-1-ene |
| SMILES | CC(C)(C=COC=CC(C)(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F6O/c1-9(2,11(13,14)15)5-7-19-8-6-10(3,4)12(16,17)18/h5-8H,1-4H3 |
| InChIKey | VAGBRXLDVQINBJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|