About butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate
butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate (PubChem CID 90994936) has the molecular formula C25H25Cl2N3O4S
and a molecular weight of 534.47 g/mol. Its IUPAC name is butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate.
Molecular Properties
| Compound Name | butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate |
| PubChem CID | 90994936 |
| Molecular Formula | C25H25Cl2N3O4S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate |
| SMILES | CCCCOC(=O)CN(c1ccc2c(c1)c1ccccc1n2CC)S(=O)(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C25H25Cl2N3O4S/c1-3-5-12-34-25(31)16-30(35(32,33)18-14-23(26)28-24(27)15-18)17-10-11-22-20(13-17)19-8-6-7-9-21(19)29(22)4-2/h6-11,13-15H,3-5,12,16H2,1-2H3 |
| InChIKey | IQCAUQWRAXJIMP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate?
The IUPAC name of butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate (CID 90994936) is butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate.
What is the SMILES notation for butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate?
The canonical SMILES for butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate is CCCCOC(=O)CN(c1ccc2c(c1)c1ccccc1n2CC)S(=O)(=O)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate?
The InChIKey is IQCAUQWRAXJIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25Cl2N3O4S/c1-3-5-12-34-25(31)16-30(35(32,33)18-14-23(26)28-24(27)15-18)17-10-11-22-20(13-17)19-8-6-7-9-21(19)29(22)4-2/h6-11,13-15H,3-5,12,16H2,1-2H3.
What are the key properties of butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate?
butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate has a molecular weight of 534.47 g/mol, XLogP of 6.05, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[(2,6-dichloro-4-pyridinyl)sulfonyl-(9-ethylcarbazol-3-yl)amino]acetate is sourced from PubChem (CID 90994936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).