C21H38 — CID 90995011
2-(2-methylbutan-2-yl)-1,4-dimethylidene-3-(2,4,4-trimethylhexan-2-yl)cyclopentane (PubChem CID 90995011) has the molecular formula C21H38 and a molecular weight of 290.53 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-1,4-dimethylidene-3-(2,4,4-trimethylhexan-2-yl)cyclopentane.
| Compound Name | 2-(2-methylbutan-2-yl)-1,4-dimethylidene-3-(2,4,4-trimethylhexan-2-yl)cyclopentane |
|---|---|
| PubChem CID | 90995011 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-1,4-dimethylidene-3-(2,4,4-trimethylhexan-2-yl)cyclopentane |
| SMILES | C=C1CC(=C)C(C(C)(C)CC(C)(C)CC)C1C(C)(C)CC |
| InChI | InChI=1S/C21H38/c1-11-19(5,6)14-21(9,10)18-16(4)13-15(3)17(18)20(7,8)12-2/h17-18H,3-4,11-14H2,1-2,5-10H3 |
| InChIKey | OSAUBGPCCRPCMF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|