C32H56N8 — CID 90995297
33,34,35,36,37,38,39,40-octazanonacyclo[28.2.1.12,5.16,9.110,13.114,17.118,21.122,25.126,29]tetracontane (PubChem CID 90995297) has the molecular formula C32H56N8 and a molecular weight of 552.86 g/mol. Its IUPAC name is 33,34,35,36,37,38,39,40-octazanonacyclo[28.2.1.12,5.16,9.110,13.114,17.118,21.122,25.126,29]tetracontane.
| Compound Name | 33,34,35,36,37,38,39,40-octazanonacyclo[28.2.1.12,5.16,9.110,13.114,17.118,21.122,25.126,29]tetracontane |
|---|---|
| PubChem CID | 90995297 |
| Molecular Formula | C32H56N8 |
| Molecular Weight | 552.86 g/mol |
| Exact Mass | 552.46 |
| IUPAC Name | 33,34,35,36,37,38,39,40-octazanonacyclo[28.2.1.12,5.16,9.110,13.114,17.118,21.122,25.126,29]tetracontane |
| SMILES | C1CC2NC1C1CCC(N1)C1CCC(N1)C1CCC(N1)C1CCC(N1)C1CCC(N1)C1CCC(N1)C1CCC2N1 |
| InChI | InChI=1S/C32H56N8/c1-2-18-20-5-6-23(35-20)24-9-10-27(37-24)28-13-14-31(39-28)32-16-15-30(40-32)29-12-11-26(38-29)25-8-7-22(36-25)21-4-3-19(34-21)17(1)33-18/h17-40H,1-16H2 |
| InChIKey | SWZZRVMNLGMBIP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 96.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.86 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|